C18H27N5O2 — CID 6620367
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide (PubChem CID 6620367) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 6620367 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)Cn2ncn3cccc3c2=O)C1 |
| InChI | InChI=1S/C18H27N5O2/c1-14-9-15(2)11-21(10-14)7-4-6-19-17(24)12-23-18(25)16-5-3-8-22(16)13-20-23/h3,5,8,13-15H,4,6-7,9-12H2,1-2H3,(H,19,24) |
| InChIKey | LFTCBTMDLNAUEO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|