C11H17N7O3 — CID 66205412
2-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide (PubChem CID 66205412) has the molecular formula C11H17N7O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide.
| Compound Name | 2-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 66205412 |
| Molecular Formula | C11H17N7O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide |
| SMILES | COCCNCc1cn(CC(=O)Nc2nnc(C)o2)nn1 |
| InChI | InChI=1S/C11H17N7O3/c1-8-14-16-11(21-8)13-10(19)7-18-6-9(15-17-18)5-12-3-4-20-2/h6,12H,3-5,7H2,1-2H3,(H,13,16,19) |
| InChIKey | GFLLFDRXCMJJMJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|