C11H16N4OS — CID 66205423
2-methoxy-N-[[1-(thiophen-3-ylmethyl)triazol-4-yl]methyl]ethanamine (PubChem CID 66205423) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-methoxy-N-[[1-(thiophen-3-ylmethyl)triazol-4-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[1-(thiophen-3-ylmethyl)triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 66205423 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-methoxy-N-[[1-(thiophen-3-ylmethyl)triazol-4-yl]methyl]ethanamine |
| SMILES | COCCNCc1cn(Cc2ccsc2)nn1 |
| InChI | InChI=1S/C11H16N4OS/c1-16-4-3-12-6-11-8-15(14-13-11)7-10-2-5-17-9-10/h2,5,8-9,12H,3-4,6-7H2,1H3 |
| InChIKey | VLFRLYNNVACBIT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|