About 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one
3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one (PubChem CID 6620582) has the molecular formula C20H22N2O3S
and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one |
| PubChem CID | 6620582 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CC/N=C2\SCC(=O)N2Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H22N2O3S/c1-24-17-9-8-15(12-18(17)25-2)10-11-21-20-22(19(23)14-26-20)13-16-6-4-3-5-7-16/h3-9,12H,10-11,13-14H2,1-2H3/b21-20- |
| InChIKey | AGPRFPNGIICXFS-MRCUWXFGSA-N |
| XLogP | 3.38 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one?
The IUPAC name of 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one (CID 6620582) is 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one?
The canonical SMILES for 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one is COc1ccc(CC/N=C2\SCC(=O)N2Cc2ccccc2)cc1OC.
What is the InChIKey of 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one?
The InChIKey is AGPRFPNGIICXFS-MRCUWXFGSA-N. The full InChI is InChI=1S/C20H22N2O3S/c1-24-17-9-8-15(12-18(17)25-2)10-11-21-20-22(19(23)14-26-20)13-16-6-4-3-5-7-16/h3-9,12H,10-11,13-14H2,1-2H3/b21-20-.
What are the key properties of 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one?
3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one has a molecular weight of 370.47 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-[2-(3,4-dimethoxyphenyl)ethylimino]-1,3-thiazolidin-4-one is sourced from PubChem (CID 6620582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).