C20H26N2O3 — CID 6620638
3-[2-(cycloheptylamino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid (PubChem CID 6620638) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[2-(cycloheptylamino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid.
| Compound Name | 3-[2-(cycloheptylamino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 6620638 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[2-(cycloheptylamino)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)c(CC(=O)NC2CCCCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H26N2O3/c1-2-22-17-12-8-7-11-15(17)16(19(22)20(24)25)13-18(23)21-14-9-5-3-4-6-10-14/h7-8,11-12,14H,2-6,9-10,13H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | UYUFAXZXBYMLLH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|