C12H12Cl2N6S — CID 66206728
N-[[1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 66206728) has the molecular formula C12H12Cl2N6S and a molecular weight of 343.24 g/mol. Its IUPAC name is N-[[1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66206728 |
| Molecular Formula | C12H12Cl2N6S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-[[1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(-c2c(Cl)cc(Cl)c3nsnc23)nn1 |
| InChI | InChI=1S/C12H12Cl2N6S/c1-2-3-15-5-7-6-20(19-16-7)12-9(14)4-8(13)10-11(12)18-21-17-10/h4,6,15H,2-3,5H2,1H3 |
| InChIKey | RABZQKAKKCTDLF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|