C14H16Cl2N2O — CID 66206820
4-(2,6-dichlorophenyl)-5-(2,2-dimethylpropyl)-1,2-oxazol-3-amine (PubChem CID 66206820) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-5-(2,2-dimethylpropyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2,6-dichlorophenyl)-5-(2,2-dimethylpropyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66206820 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-5-(2,2-dimethylpropyl)-1,2-oxazol-3-amine |
| SMILES | CC(C)(C)Cc1onc(N)c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O/c1-14(2,3)7-10-12(13(17)18-19-10)11-8(15)5-4-6-9(11)16/h4-6H,7H2,1-3H3,(H2,17,18) |
| InChIKey | YFDRNPWHLONNBC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |