About [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium
[2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium (PubChem CID 6620693) has the molecular formula C22H32NO+
and a molecular weight of 326.50 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium.
Molecular Properties
| Compound Name | [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium |
| PubChem CID | 6620693 |
| Molecular Formula | C22H32NO+ |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium |
| SMILES | Cc1ccc(C(OCC(C)(C)C[N+](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H32NO/c1-18-12-14-20(15-13-18)21(19-10-8-7-9-11-19)24-17-22(2,3)16-23(4,5)6/h7-15,21H,16-17H2,1-6H3/q+1 |
| InChIKey | KVCBXTIXYHRCSQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium?
The IUPAC name of [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium (CID 6620693) is [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium.
What is the SMILES notation for [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium?
The canonical SMILES for [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium is Cc1ccc(C(OCC(C)(C)C[N+](C)(C)C)c2ccccc2)cc1.
What is the InChIKey of [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium?
The InChIKey is KVCBXTIXYHRCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32NO/c1-18-12-14-20(15-13-18)21(19-10-8-7-9-11-19)24-17-22(2,3)16-23(4,5)6/h7-15,21H,16-17H2,1-6H3/q+1.
What are the key properties of [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium?
[2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium has a molecular weight of 326.50 g/mol, XLogP of 4.83, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-3-[(4-methylphenyl)-phenylmethoxy]propyl]-trimethylazanium is sourced from PubChem (CID 6620693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).