About N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine
N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine (PubChem CID 66207291) has the molecular formula C12H13Br3N4
and a molecular weight of 452.98 g/mol. Its IUPAC name is N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine |
| PubChem CID | 66207291 |
| Molecular Formula | C12H13Br3N4 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 449.87 |
| IUPAC Name | N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cn(-c2c(Br)cc(Br)cc2Br)nn1 |
| InChI | InChI=1S/C12H13Br3N4/c1-7(2)16-5-9-6-19(18-17-9)12-10(14)3-8(13)4-11(12)15/h3-4,6-7,16H,5H2,1-2H3 |
| InChIKey | LHDYWGFFGRUORN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine?
The IUPAC name of N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine (CID 66207291) is N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine is CC(C)NCc1cn(-c2c(Br)cc(Br)cc2Br)nn1.
What is the InChIKey of N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine?
The InChIKey is LHDYWGFFGRUORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br3N4/c1-7(2)16-5-9-6-19(18-17-9)12-10(14)3-8(13)4-11(12)15/h3-4,6-7,16H,5H2,1-2H3.
What are the key properties of N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine?
N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine has a molecular weight of 452.98 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2,4,6-tribromophenyl)triazol-4-yl]methyl]propan-2-amine is sourced from PubChem (CID 66207291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).