About N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine
N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 66207333) has the molecular formula C12H13ClN6S
and a molecular weight of 308.80 g/mol. Its IUPAC name is N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine |
| PubChem CID | 66207333 |
| Molecular Formula | C12H13ClN6S |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(-c2c(Cl)ccc3nsnc23)nn1 |
| InChI | InChI=1S/C12H13ClN6S/c1-2-5-14-6-8-7-19(18-15-8)12-9(13)3-4-10-11(12)17-20-16-10/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | XMCODNWFFMMGMR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine?
The IUPAC name of N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine (CID 66207333) is N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine.
What is the SMILES notation for N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine?
The canonical SMILES for N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine is CCCNCc1cn(-c2c(Cl)ccc3nsnc23)nn1.
What is the InChIKey of N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine?
The InChIKey is XMCODNWFFMMGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN6S/c1-2-5-14-6-8-7-19(18-15-8)12-9(13)3-4-10-11(12)17-20-16-10/h3-4,7,14H,2,5-6H2,1H3.
What are the key properties of N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine?
N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine has a molecular weight of 308.80 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(5-chloro-2,1,3-benzothiadiazol-4-yl)triazol-4-yl]methyl]propan-1-amine is sourced from PubChem (CID 66207333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).