C13H24N4O2 — CID 66207587
2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(ethylcarbamoyl)acetamide (PubChem CID 66207587) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 66207587 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN1CC2CNCC2C1CC |
| InChI | InChI=1S/C13H24N4O2/c1-3-11-10-6-14-5-9(10)7-17(11)8-12(18)16-13(19)15-4-2/h9-11,14H,3-8H2,1-2H3,(H2,15,16,18,19) |
| InChIKey | KAXLINFEUFDBNG-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |