C13H24N2O — CID 66207599
2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol (PubChem CID 66207599) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol.
| Compound Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 66207599 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol |
| SMILES | CCC1C2CNCC2CN1C1CCCC1O |
| InChI | InChI=1S/C13H24N2O/c1-2-11-10-7-14-6-9(10)8-15(11)12-4-3-5-13(12)16/h9-14,16H,2-8H2,1H3 |
| InChIKey | IZSHEQVVDIJHIR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |