C15H20ClN3O — CID 66207611
5-chloro-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzamide (PubChem CID 66207611) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 5-chloro-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzamide.
| Compound Name | 5-chloro-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzamide |
|---|---|
| PubChem CID | 66207611 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-chloro-2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzamide |
| SMILES | CCC1C2CNCC2CN1c1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C15H20ClN3O/c1-2-13-12-7-18-6-9(12)8-19(13)14-4-3-10(16)5-11(14)15(17)20/h3-5,9,12-13,18H,2,6-8H2,1H3,(H2,17,20) |
| InChIKey | BNDJVGFKFDGWME-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |