C12H22N4O2 — CID 66207669
N-(ethylcarbamoyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide (PubChem CID 66207669) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide |
|---|---|
| PubChem CID | 66207669 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-(ethylcarbamoyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN1CC2CNCC2C1C |
| InChI | InChI=1S/C12H22N4O2/c1-3-14-12(18)15-11(17)7-16-6-9-4-13-5-10(9)8(16)2/h8-10,13H,3-7H2,1-2H3,(H2,14,15,17,18) |
| InChIKey | GHBLDJCSBSWLIN-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |