C14H22N4O2 — CID 66207677
1,3-dimethyl-6-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]pyrimidine-2,4-dione (PubChem CID 66207677) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1,3-dimethyl-6-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66207677 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1,3-dimethyl-6-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]pyrimidine-2,4-dione |
| SMILES | CC1C2CNCC2CN1Cc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H22N4O2/c1-9-12-6-15-5-10(12)7-18(9)8-11-4-13(19)17(3)14(20)16(11)2/h4,9-10,12,15H,5-8H2,1-3H3 |
| InChIKey | MYVMZVDCEDGMLJ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |