C10H18F2N2 — CID 66207788
5-(2,2-difluoroethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66207788) has the molecular formula C10H18F2N2 and a molecular weight of 204.26 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2,2-difluoroethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66207788 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 5-(2,2-difluoroethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1CC(F)F |
| InChI | InChI=1S/C10H18F2N2/c1-2-9-8-4-13-3-7(8)5-14(9)6-10(11)12/h7-10,13H,2-6H2,1H3 |
| InChIKey | SRBGBGMDLNVACH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |