C14H25N3O — CID 66207833
N-cyclohexyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 66207833) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | N-cyclohexyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 66207833 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-cyclohexyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CC1C2CNCC2CN1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H25N3O/c1-10-13-8-15-7-11(13)9-17(10)14(18)16-12-5-3-2-4-6-12/h10-13,15H,2-9H2,1H3,(H,16,18) |
| InChIKey | SWORUWMYQWKAQO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |