C14H24N4O2 — CID 66207863
5,5-dimethyl-3-[2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 66207863) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66207863 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 5,5-dimethyl-3-[2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1C2CNCC2CN1CCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C14H24N4O2/c1-9-11-7-15-6-10(11)8-17(9)4-5-18-12(19)14(2,3)16-13(18)20/h9-11,15H,4-8H2,1-3H3,(H,16,20) |
| InChIKey | GMKWIMGHORLABQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|