C16H28N2O2 — CID 66207982
5-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66207982) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 5-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66207982 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 5-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1CC1COC2(CCCC2)O1 |
| InChI | InChI=1S/C16H28N2O2/c1-2-15-14-8-17-7-12(14)9-18(15)10-13-11-19-16(20-13)5-3-4-6-16/h12-15,17H,2-11H2,1H3 |
| InChIKey | HDCHMXJUJQYVJZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |