C13H17N5O2S — CID 66208003
6-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 66208003) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 6-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 66208003 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 6-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCC1C2CNCC2CN1c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N5O2S/c1-2-10-9-6-14-5-8(9)7-17(10)11-12(18(19)20)16-3-4-21-13(16)15-11/h3-4,8-10,14H,2,5-7H2,1H3 |
| InChIKey | RQWIGRUEQUAGGA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|