C16H22BrFN2 — CID 66208009
5-[1-(3-bromo-4-fluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66208009) has the molecular formula C16H22BrFN2 and a molecular weight of 341.27 g/mol. Its IUPAC name is 5-[1-(3-bromo-4-fluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[1-(3-bromo-4-fluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66208009 |
| Molecular Formula | C16H22BrFN2 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 5-[1-(3-bromo-4-fluorophenyl)ethyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(c1ccc(F)c(Br)c1)N1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C16H22BrFN2/c1-10(11-4-5-15(18)14(17)6-11)20-9-12-7-19-8-13(12)16(20,2)3/h4-6,10,12-13,19H,7-9H2,1-3H3 |
| InChIKey | AKOACHFXFPTZOO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |