C12H22N2O — CID 66208074
2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol (PubChem CID 66208074) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol.
| Compound Name | 2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 66208074 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)cyclopentan-1-ol |
| SMILES | CC1C2CNCC2CN1C1CCCC1O |
| InChI | InChI=1S/C12H22N2O/c1-8-10-6-13-5-9(10)7-14(8)11-3-2-4-12(11)15/h8-13,15H,2-7H2,1H3 |
| InChIKey | FSZGLRCHYWYNRX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |