C14H20N2O3 — CID 66208266
methyl 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate (PubChem CID 66208266) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 66208266 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | methyl 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CN1CC2CNCC2C1C |
| InChI | InChI=1S/C14H20N2O3/c1-9-12-6-15-5-10(12)7-16(9)8-13-11(3-4-19-13)14(17)18-2/h3-4,9-10,12,15H,5-8H2,1-2H3 |
| InChIKey | NNVWHDSQYUZOHF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |