C14H18N4 — CID 66208279
6-methyl-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-3-carbonitrile (PubChem CID 66208279) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 6-methyl-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 66208279 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 6-methyl-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(N2CC3CNCC3C2C)n1 |
| InChI | InChI=1S/C14H18N4/c1-9-3-4-11(5-15)14(17-9)18-8-12-6-16-7-13(12)10(18)2/h3-4,10,12-13,16H,6-8H2,1-2H3 |
| InChIKey | FTUOQOUETWJYSD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |