C14H18N4OS — CID 66208449
3-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-5-thiophen-3-yl-1,2,4-oxadiazole (PubChem CID 66208449) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-5-thiophen-3-yl-1,2,4-oxadiazole.
| Compound Name | 3-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-5-thiophen-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66208449 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-5-thiophen-3-yl-1,2,4-oxadiazole |
| SMILES | CC1C2CNCC2CN1Cc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-9-12-5-15-4-11(12)6-18(9)7-13-16-14(19-17-13)10-2-3-20-8-10/h2-3,8-9,11-12,15H,4-7H2,1H3 |
| InChIKey | JNEHWWCENFZSCK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |