C15H21ClN2O — CID 66208487
4-chloro-2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol (PubChem CID 66208487) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 4-chloro-2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol.
| Compound Name | 4-chloro-2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol |
|---|---|
| PubChem CID | 66208487 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-chloro-2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]phenol |
| SMILES | CCC1C2CNCC2CN1Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H21ClN2O/c1-2-14-13-7-17-6-11(13)9-18(14)8-10-5-12(16)3-4-15(10)19/h3-5,11,13-14,17,19H,2,6-9H2,1H3 |
| InChIKey | GOSDWVFUBHWJTD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|