C14H26N2O — CID 66208549
1-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopentan-1-ol (PubChem CID 66208549) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopentan-1-ol.
| Compound Name | 1-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 66208549 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopentan-1-ol |
| SMILES | CCC1C2CNCC2CN1CC1(O)CCCC1 |
| InChI | InChI=1S/C14H26N2O/c1-2-13-12-8-15-7-11(12)9-16(13)10-14(17)5-3-4-6-14/h11-13,15,17H,2-10H2,1H3 |
| InChIKey | LBECTKLORBFAII-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |