C12H22N4O2 — CID 66208763
N-carbamoyl-3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide (PubChem CID 66208763) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-carbamoyl-3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide.
| Compound Name | N-carbamoyl-3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide |
|---|---|
| PubChem CID | 66208763 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-carbamoyl-3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propanamide |
| SMILES | CCC1C2CNCC2CN1CCC(=O)NC(N)=O |
| InChI | InChI=1S/C12H22N4O2/c1-2-10-9-6-14-5-8(9)7-16(10)4-3-11(17)15-12(13)18/h8-10,14H,2-7H2,1H3,(H3,13,15,17,18) |
| InChIKey | QYKOKRBIBNESJP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |