C12H15N5 — CID 66208860
5-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile (PubChem CID 66208860) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 5-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile.
| Compound Name | 5-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 66208860 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 5-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrazine-2-carbonitrile |
| SMILES | CC1C2CNCC2CN1c1cnc(C#N)cn1 |
| InChI | InChI=1S/C12H15N5/c1-8-11-5-14-3-9(11)7-17(8)12-6-15-10(2-13)4-16-12/h4,6,8-9,11,14H,3,5,7H2,1H3 |
| InChIKey | VFFZALRZAMUOMK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |