C12H19N5O — CID 66208896
1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 66208896) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 66208896 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | CCC1C2CNCC2CN1C(=O)Cn1cncn1 |
| InChI | InChI=1S/C12H19N5O/c1-2-11-10-4-13-3-9(10)5-17(11)12(18)6-16-8-14-7-15-16/h7-11,13H,2-6H2,1H3 |
| InChIKey | PVMZMYUQUGWPQF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |