C13H18N4O2 — CID 66209086
5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrazin-2-one (PubChem CID 66209086) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrazin-2-one.
| Compound Name | 5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 66209086 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1H-pyrazin-2-one |
| SMILES | CCC1C2CNCC2CN1C(=O)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C13H18N4O2/c1-2-11-9-4-14-3-8(9)7-17(11)13(19)10-5-16-12(18)6-15-10/h5-6,8-9,11,14H,2-4,7H2,1H3,(H,16,18) |
| InChIKey | ACFZBBGZPOFAIB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |