C13H23F3N2O — CID 66209143
4-ethyl-5-[3-(2,2,2-trifluoroethoxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66209143) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-ethyl-5-[3-(2,2,2-trifluoroethoxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-ethyl-5-[3-(2,2,2-trifluoroethoxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209143 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4-ethyl-5-[3-(2,2,2-trifluoroethoxy)propyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1CCCOCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O/c1-2-12-11-7-17-6-10(11)8-18(12)4-3-5-19-9-13(14,15)16/h10-12,17H,2-9H2,1H3 |
| InChIKey | NYEHMTHNXQQHHW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|