C9H15N3O2S — CID 66209190
2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]acetonitrile (PubChem CID 66209190) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]acetonitrile.
| Compound Name | 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]acetonitrile |
|---|---|
| PubChem CID | 66209190 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]acetonitrile |
| SMILES | CC1C2CNCC2CN1S(=O)(=O)CC#N |
| InChI | InChI=1S/C9H15N3O2S/c1-7-9-5-11-4-8(9)6-12(7)15(13,14)3-2-10/h7-9,11H,3-6H2,1H3 |
| InChIKey | SUOGBVLOCKMFGZ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |