C13H21N5O — CID 66209285
1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 66209285) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 66209285 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CCC1C2CNCC2CN1C(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C13H21N5O/c1-3-12-11-5-14-4-10(11)6-17(12)13(19)9(2)18-8-15-7-16-18/h7-12,14H,3-6H2,1-2H3 |
| InChIKey | FPZGXDAZCMHWMK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |