C17H24N4 — CID 66209525
2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-6-methylimidazo[1,2-a]pyridine (PubChem CID 66209525) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-6-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-6-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 66209525 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-6-methylimidazo[1,2-a]pyridine |
| SMILES | CCC1C2CNCC2CN1Cc1cn2cc(C)ccc2n1 |
| InChI | InChI=1S/C17H24N4/c1-3-16-15-7-18-6-13(15)9-20(16)10-14-11-21-8-12(2)4-5-17(21)19-14/h4-5,8,11,13,15-16,18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | BKOQDXOKINVHEY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |