C10H14N4OS — CID 66209570
(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 66209570) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 66209570 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | CC1C2CNCC2CN1C(=O)c1cnsn1 |
| InChI | InChI=1S/C10H14N4OS/c1-6-8-3-11-2-7(8)5-14(6)10(15)9-4-12-16-13-9/h4,6-8,11H,2-3,5H2,1H3 |
| InChIKey | HIIVHSMBJUKDJP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |