C15H18BrClN2O — CID 66209682
(4-bromo-2-chlorophenyl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66209682) has the molecular formula C15H18BrClN2O and a molecular weight of 357.68 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | (4-bromo-2-chlorophenyl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66209682 |
| Molecular Formula | C15H18BrClN2O |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (4-bromo-2-chlorophenyl)-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CCC1C2CNCC2CN1C(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H18BrClN2O/c1-2-14-12-7-18-6-9(12)8-19(14)15(20)11-4-3-10(16)5-13(11)17/h3-5,9,12,14,18H,2,6-8H2,1H3 |
| InChIKey | LIZMFIDLBIUMCJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |