C15H25F3N2 — CID 66209748
4,4-dimethyl-5-[4-(trifluoromethyl)cyclohexyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66209748) has the molecular formula C15H25F3N2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4,4-dimethyl-5-[4-(trifluoromethyl)cyclohexyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-[4-(trifluoromethyl)cyclohexyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209748 |
| Molecular Formula | C15H25F3N2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 4,4-dimethyl-5-[4-(trifluoromethyl)cyclohexyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H25F3N2/c1-14(2)13-8-19-7-10(13)9-20(14)12-5-3-11(4-6-12)15(16,17)18/h10-13,19H,3-9H2,1-2H3 |
| InChIKey | OETUDGDQIXZSBQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |