C14H22N2S — CID 66209753
4,4-dimethyl-5-(1-thiophen-3-ylethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66209753) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 4,4-dimethyl-5-(1-thiophen-3-ylethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(1-thiophen-3-ylethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209753 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4,4-dimethyl-5-(1-thiophen-3-ylethyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(c1ccsc1)N1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C14H22N2S/c1-10(11-4-5-17-9-11)16-8-12-6-15-7-13(12)14(16,2)3/h4-5,9-10,12-13,15H,6-8H2,1-3H3 |
| InChIKey | XKHHDRSHYSDVQX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |