C14H18N4S — CID 66209822
6-methyl-4-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thieno[2,3-d]pyrimidine (PubChem CID 66209822) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 6-methyl-4-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 6-methyl-4-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 66209822 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-methyl-4-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1cc2c(N3CC4CNCC4C3C)ncnc2s1 |
| InChI | InChI=1S/C14H18N4S/c1-8-3-11-13(16-7-17-14(11)19-8)18-6-10-4-15-5-12(10)9(18)2/h3,7,9-10,12,15H,4-6H2,1-2H3 |
| InChIKey | SVQHBWCOYWEVEK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |