C12H18N4O2 — CID 66209861
4-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1,3-dihydroimidazol-2-one (PubChem CID 66209861) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1,3-dihydroimidazol-2-one.
| Compound Name | 4-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 66209861 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-1,3-dihydroimidazol-2-one |
| SMILES | CCC1C2CNCC2CN1C(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H18N4O2/c1-2-10-8-4-13-3-7(8)6-16(10)11(17)9-5-14-12(18)15-9/h5,7-8,10,13H,2-4,6H2,1H3,(H2,14,15,18) |
| InChIKey | VMWKCZPQNHHROX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |