C9H15F3N2O2S — CID 66209884
4-ethyl-5-(trifluoromethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66209884) has the molecular formula C9H15F3N2O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is 4-ethyl-5-(trifluoromethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-ethyl-5-(trifluoromethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209884 |
| Molecular Formula | C9H15F3N2O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-ethyl-5-(trifluoromethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2S/c1-2-8-7-4-13-3-6(7)5-14(8)17(15,16)9(10,11)12/h6-8,13H,2-5H2,1H3 |
| InChIKey | HSTGJDYXIMAMQJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |