C11H15ClN2O2S2 — CID 66209964
5-(5-chlorothiophen-2-yl)sulfonyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66209964) has the molecular formula C11H15ClN2O2S2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)sulfonyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(5-chlorothiophen-2-yl)sulfonyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209964 |
| Molecular Formula | C11H15ClN2O2S2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)sulfonyl-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H15ClN2O2S2/c1-7-9-5-13-4-8(9)6-14(7)18(15,16)11-3-2-10(12)17-11/h2-3,7-9,13H,4-6H2,1H3 |
| InChIKey | PIWOPRLYMCPQGX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |