C11H18F3N3O — CID 66210002
2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 66210002) has the molecular formula C11H18F3N3O and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 66210002 |
| Molecular Formula | C11H18F3N3O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC1C2CNCC2CN1CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O/c1-7-9-3-15-2-8(9)4-17(7)5-10(18)16-6-11(12,13)14/h7-9,15H,2-6H2,1H3,(H,16,18) |
| InChIKey | DOAGRTBVMJVYAD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |