C17H22N4 — CID 66210118
2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 66210118) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 66210118 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | CCC1C2CNCC2CN1c1nc2c(cc1C#N)CCC2 |
| InChI | InChI=1S/C17H22N4/c1-2-16-14-9-19-8-13(14)10-21(16)17-12(7-18)6-11-4-3-5-15(11)20-17/h6,13-14,16,19H,2-5,8-10H2,1H3 |
| InChIKey | DGXXNEMMRWAKRC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |