C17H32N2 — CID 66210328
4,4-dimethyl-5-(3,3,5-trimethylcyclohexyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66210328) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 4,4-dimethyl-5-(3,3,5-trimethylcyclohexyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(3,3,5-trimethylcyclohexyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66210328 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 4,4-dimethyl-5-(3,3,5-trimethylcyclohexyl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1CC(N2CC3CNCC3C2(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H32N2/c1-12-6-14(8-16(2,3)7-12)19-11-13-9-18-10-15(13)17(19,4)5/h12-15,18H,6-11H2,1-5H3 |
| InChIKey | UGRQMMARVWFIPE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |