C11H17N3O3S — CID 66210767
N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 66210767) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 66210767 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | NC1C2CCCOC2C1NC(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C11H17N3O3S/c12-7-5-2-1-3-17-9(5)8(7)14-10(15)6-4-18-11(16)13-6/h5-9H,1-4,12H2,(H,13,16)(H,14,15) |
| InChIKey | LWBDKDCMMFXAHI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|