About 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine
8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine (PubChem CID 66211561) has the molecular formula C14H16BrF3N2O
and a molecular weight of 365.19 g/mol. Its IUPAC name is 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine.
Molecular Properties
| Compound Name | 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| PubChem CID | 66211561 |
| Molecular Formula | C14H16BrF3N2O |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| SMILES | NC1C2CCCOC2C1Nc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16BrF3N2O/c15-7-3-4-10(9(6-7)14(16,17)18)20-12-11(19)8-2-1-5-21-13(8)12/h3-4,6,8,11-13,20H,1-2,5,19H2 |
| InChIKey | ZJLIWOJBOITATK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The IUPAC name of 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine (CID 66211561) is 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine.
What is the SMILES notation for 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The canonical SMILES for 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine is NC1C2CCCOC2C1Nc1ccc(Br)cc1C(F)(F)F.
What is the InChIKey of 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The InChIKey is ZJLIWOJBOITATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrF3N2O/c15-7-3-4-10(9(6-7)14(16,17)18)20-12-11(19)8-2-1-5-21-13(8)12/h3-4,6,8,11-13,20H,1-2,5,19H2.
What are the key properties of 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine has a molecular weight of 365.19 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-[4-bromo-2-(trifluoromethyl)phenyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine is sourced from PubChem (CID 66211561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).