C12H15N3O — CID 66211794
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridin-2-yl)methanone (PubChem CID 66211794) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridin-2-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 66211794 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridin-2-yl)methanone |
| SMILES | O=C(c1ccccn1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C12H15N3O/c16-12(11-3-1-2-4-14-11)15-7-9-5-13-6-10(9)8-15/h1-4,9-10,13H,5-8H2 |
| InChIKey | KPURMDWMUNJNJZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |