About 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine
8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine (PubChem CID 66211939) has the molecular formula C13H16F3N3O
and a molecular weight of 287.29 g/mol. Its IUPAC name is 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine.
Molecular Properties
| Compound Name | 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| PubChem CID | 66211939 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| SMILES | NC1C2CCCOC2C1Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)8-4-1-5-9(18-8)19-11-10(17)7-3-2-6-20-12(7)11/h1,4-5,7,10-12H,2-3,6,17H2,(H,18,19) |
| InChIKey | KFZCIQUYTGHFIW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The IUPAC name of 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine (CID 66211939) is 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine.
What is the SMILES notation for 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The canonical SMILES for 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine is NC1C2CCCOC2C1Nc1cccc(C(F)(F)F)n1.
What is the InChIKey of 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
The InChIKey is KFZCIQUYTGHFIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N3O/c14-13(15,16)8-4-1-5-9(18-8)19-11-10(17)7-3-2-6-20-12(7)11/h1,4-5,7,10-12H,2-3,6,17H2,(H,18,19).
What are the key properties of 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine?
8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine has a molecular weight of 287.29 g/mol, XLogP of 2.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-[6-(trifluoromethyl)-2-pyridinyl]-2-oxabicyclo[4.2.0]octane-7,8-diamine is sourced from PubChem (CID 66211939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).